C10H15N3O2 — CID 114474267
3-[(5,6-dimethylpyrazin-2-yl)amino]butanoic acid (PubChem CID 114474267) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 3-[(5,6-dimethylpyrazin-2-yl)amino]butanoic acid.
| Compound Name | 3-[(5,6-dimethylpyrazin-2-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 114474267 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 3-[(5,6-dimethylpyrazin-2-yl)amino]butanoic acid |
| SMILES | Cc1ncc(NC(C)CC(=O)O)nc1C |
| InChI | InChI=1S/C10H15N3O2/c1-6(4-10(14)15)12-9-5-11-7(2)8(3)13-9/h5-6H,4H2,1-3H3,(H,12,13)(H,14,15) |
| InChIKey | VMNDYEZDKUBFCY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |