3-[(5,6-dimethylpyrazin-2-yl)amino]butanoic acid

C10H15N3O2 — CID 114474267

IUPAC3-[(5,6-dimethylpyrazin-2-yl)amino]butanoic acid
SMILESCc1ncc(NC(C)CC(=O)O)nc1C
InChIInChI=1S/C10H15N3O2/c1-6(4-10(14)15)12-9-5-11-7(2)8(3)13-9/h5-6H,4H2,1-3H3,(H,12,13)(H,14,15)
InChIKeyVMNDYEZDKUBFCY-UHFFFAOYSA-N
MW209.25 g/mol
LogP1.37
Rot. Bonds4

About 3-[(5,6-dimethylpyrazin-2-yl)amino]butanoic acid

3-[(5,6-dimethylpyrazin-2-yl)amino]butanoic acid (PubChem CID 114474267) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 3-[(5,6-dimethylpyrazin-2-yl)amino]butanoic acid.

Molecular Properties

Compound Name3-[(5,6-dimethylpyrazin-2-yl)amino]butanoic acid
PubChem CID114474267
Molecular FormulaC10H15N3O2
Molecular Weight209.25 g/mol
Exact Mass209.12
IUPAC Name3-[(5,6-dimethylpyrazin-2-yl)amino]butanoic acid
SMILESCc1ncc(NC(C)CC(=O)O)nc1C
InChIInChI=1S/C10H15N3O2/c1-6(4-10(14)15)12-9-5-11-7(2)8(3)13-9/h5-6H,4H2,1-3H3,(H,12,13)(H,14,15)
InChIKeyVMNDYEZDKUBFCY-UHFFFAOYSA-N
XLogP1.37
TPSA75.11 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.25
LogP ≤ 51.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-[(5,6-dimethylpyrazin-2-yl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(5,6-dimethylpyrazin-2-yl)amino]butanoic acid?
The IUPAC name of 3-[(5,6-dimethylpyrazin-2-yl)amino]butanoic acid (CID 114474267) is 3-[(5,6-dimethylpyrazin-2-yl)amino]butanoic acid.
What is the SMILES notation for 3-[(5,6-dimethylpyrazin-2-yl)amino]butanoic acid?
The canonical SMILES for 3-[(5,6-dimethylpyrazin-2-yl)amino]butanoic acid is Cc1ncc(NC(C)CC(=O)O)nc1C.
What is the InChIKey of 3-[(5,6-dimethylpyrazin-2-yl)amino]butanoic acid?
The InChIKey is VMNDYEZDKUBFCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2/c1-6(4-10(14)15)12-9-5-11-7(2)8(3)13-9/h5-6H,4H2,1-3H3,(H,12,13)(H,14,15).
What are the key properties of 3-[(5,6-dimethylpyrazin-2-yl)amino]butanoic acid?
3-[(5,6-dimethylpyrazin-2-yl)amino]butanoic acid has a molecular weight of 209.25 g/mol, XLogP of 1.37, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5,6-dimethylpyrazin-2-yl)amino]butanoic acid is sourced from PubChem (CID 114474267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).