C12H21N3 — CID 114475547
5,6-dimethyl-N-(2-methylpentan-3-yl)pyrazin-2-amine (PubChem CID 114475547) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 5,6-dimethyl-N-(2-methylpentan-3-yl)pyrazin-2-amine.
| Compound Name | 5,6-dimethyl-N-(2-methylpentan-3-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 114475547 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 5,6-dimethyl-N-(2-methylpentan-3-yl)pyrazin-2-amine |
| SMILES | CCC(Nc1cnc(C)c(C)n1)C(C)C |
| InChI | InChI=1S/C12H21N3/c1-6-11(8(2)3)15-12-7-13-9(4)10(5)14-12/h7-8,11H,6H2,1-5H3,(H,14,15) |
| InChIKey | YRLYCVHYXCUTSN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |