C10H17N3O2 — CID 106186351
2-[(5,6-dimethylpyrazin-2-yl)amino]-3-methoxypropan-1-ol (PubChem CID 106186351) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-[(5,6-dimethylpyrazin-2-yl)amino]-3-methoxypropan-1-ol.
| Compound Name | 2-[(5,6-dimethylpyrazin-2-yl)amino]-3-methoxypropan-1-ol |
|---|---|
| PubChem CID | 106186351 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 2-[(5,6-dimethylpyrazin-2-yl)amino]-3-methoxypropan-1-ol |
| SMILES | COCC(CO)Nc1cnc(C)c(C)n1 |
| InChI | InChI=1S/C10H17N3O2/c1-7-8(2)12-10(4-11-7)13-9(5-14)6-15-3/h4,9,14H,5-6H2,1-3H3,(H,12,13) |
| InChIKey | LMIYXZAYJYDXBW-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |