C11H19N3O2 — CID 114475636
N-[2-(2-methoxyethoxy)ethyl]-5,6-dimethylpyrazin-2-amine (PubChem CID 114475636) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)ethyl]-5,6-dimethylpyrazin-2-amine.
| Compound Name | N-[2-(2-methoxyethoxy)ethyl]-5,6-dimethylpyrazin-2-amine |
|---|---|
| PubChem CID | 114475636 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | N-[2-(2-methoxyethoxy)ethyl]-5,6-dimethylpyrazin-2-amine |
| SMILES | COCCOCCNc1cnc(C)c(C)n1 |
| InChI | InChI=1S/C11H19N3O2/c1-9-10(2)14-11(8-13-9)12-4-5-16-7-6-15-3/h8H,4-7H2,1-3H3,(H,12,14) |
| InChIKey | OHGWTXPMJGSUJZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|