C9H15N3O2S — CID 114475378
5,6-dimethyl-N-(2-methylsulfonylethyl)pyrazin-2-amine (PubChem CID 114475378) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is 5,6-dimethyl-N-(2-methylsulfonylethyl)pyrazin-2-amine.
| Compound Name | 5,6-dimethyl-N-(2-methylsulfonylethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 114475378 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 5,6-dimethyl-N-(2-methylsulfonylethyl)pyrazin-2-amine |
| SMILES | Cc1ncc(NCCS(C)(=O)=O)nc1C |
| InChI | InChI=1S/C9H15N3O2S/c1-7-8(2)12-9(6-11-7)10-4-5-15(3,13)14/h6H,4-5H2,1-3H3,(H,10,12) |
| InChIKey | AUNLSSLQSJJHQV-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |