C11H20N4 — CID 106127510
1-N-(5,6-dimethylpyrazin-2-yl)pentane-1,4-diamine (PubChem CID 106127510) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 1-N-(5,6-dimethylpyrazin-2-yl)pentane-1,4-diamine.
| Compound Name | 1-N-(5,6-dimethylpyrazin-2-yl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 106127510 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 1-N-(5,6-dimethylpyrazin-2-yl)pentane-1,4-diamine |
| SMILES | Cc1ncc(NCCCC(C)N)nc1C |
| InChI | InChI=1S/C11H20N4/c1-8(12)5-4-6-13-11-7-14-9(2)10(3)15-11/h7-8H,4-6,12H2,1-3H3,(H,13,15) |
| InChIKey | CXEUCGWSQJJWLS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|