C13H23N3O2 — CID 114476158
N-[4-(2-methoxyethoxy)butyl]-5,6-dimethylpyrazin-2-amine (PubChem CID 114476158) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is N-[4-(2-methoxyethoxy)butyl]-5,6-dimethylpyrazin-2-amine.
| Compound Name | N-[4-(2-methoxyethoxy)butyl]-5,6-dimethylpyrazin-2-amine |
|---|---|
| PubChem CID | 114476158 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | N-[4-(2-methoxyethoxy)butyl]-5,6-dimethylpyrazin-2-amine |
| SMILES | COCCOCCCCNc1cnc(C)c(C)n1 |
| InChI | InChI=1S/C13H23N3O2/c1-11-12(2)16-13(10-15-11)14-6-4-5-7-18-9-8-17-3/h10H,4-9H2,1-3H3,(H,14,16) |
| InChIKey | BXCJRXBFTNSLFT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|