C9H16N4O2 — CID 106198786
3-methoxy-2-[[2-(methylamino)pyrimidin-4-yl]amino]propan-1-ol (PubChem CID 106198786) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 3-methoxy-2-[[2-(methylamino)pyrimidin-4-yl]amino]propan-1-ol.
| Compound Name | 3-methoxy-2-[[2-(methylamino)pyrimidin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 106198786 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 3-methoxy-2-[[2-(methylamino)pyrimidin-4-yl]amino]propan-1-ol |
| SMILES | CNc1nccc(NC(CO)COC)n1 |
| InChI | InChI=1S/C9H16N4O2/c1-10-9-11-4-3-8(13-9)12-7(5-14)6-15-2/h3-4,7,14H,5-6H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | ACEIEOQYVOCTOZ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |