C14H25N — CID 114475921
1-(cyclohexen-1-yl)-N,5-dimethylhex-5-en-2-amine (PubChem CID 114475921) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-N,5-dimethylhex-5-en-2-amine.
| Compound Name | 1-(cyclohexen-1-yl)-N,5-dimethylhex-5-en-2-amine |
|---|---|
| PubChem CID | 114475921 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 1-(cyclohexen-1-yl)-N,5-dimethylhex-5-en-2-amine |
| SMILES | C=C(C)CCC(CC1=CCCCC1)NC |
| InChI | InChI=1S/C14H25N/c1-12(2)9-10-14(15-3)11-13-7-5-4-6-8-13/h7,14-15H,1,4-6,8-11H2,2-3H3 |
| InChIKey | HTAJDRUVDCDLGL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|