C12H15NOS — CID 114484031
4-(3-hydroxypropylsulfanylmethyl)-3-methylbenzonitrile (PubChem CID 114484031) has the molecular formula C12H15NOS and a molecular weight of 221.32 g/mol. Its IUPAC name is 4-(3-hydroxypropylsulfanylmethyl)-3-methylbenzonitrile.
| Compound Name | 4-(3-hydroxypropylsulfanylmethyl)-3-methylbenzonitrile |
|---|---|
| PubChem CID | 114484031 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 4-(3-hydroxypropylsulfanylmethyl)-3-methylbenzonitrile |
| SMILES | Cc1cc(C#N)ccc1CSCCCO |
| InChI | InChI=1S/C12H15NOS/c1-10-7-11(8-13)3-4-12(10)9-15-6-2-5-14/h3-4,7,14H,2,5-6,9H2,1H3 |
| InChIKey | PXRGKVWXITUPML-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|