C10H20N2O — CID 114486997
4-ethyl-4-propan-2-ylpyrrolidine-3-carboxamide (PubChem CID 114486997) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 4-ethyl-4-propan-2-ylpyrrolidine-3-carboxamide.
| Compound Name | 4-ethyl-4-propan-2-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 114486997 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 4-ethyl-4-propan-2-ylpyrrolidine-3-carboxamide |
| SMILES | CCC1(C(C)C)CNCC1C(N)=O |
| InChI | InChI=1S/C10H20N2O/c1-4-10(7(2)3)6-12-5-8(10)9(11)13/h7-8,12H,4-6H2,1-3H3,(H2,11,13) |
| InChIKey | SKMHCKROMCWJIQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |