C12H20F3N3O — CID 114489689
N-(3-aminopropyl)-N-methyl-2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]acetamide (PubChem CID 114489689) has the molecular formula C12H20F3N3O and a molecular weight of 279.31 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-methyl-2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]acetamide.
| Compound Name | N-(3-aminopropyl)-N-methyl-2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]acetamide |
|---|---|
| PubChem CID | 114489689 |
| Molecular Formula | C12H20F3N3O |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-(3-aminopropyl)-N-methyl-2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]acetamide |
| SMILES | CN(CCCN)C(=O)CN1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H20F3N3O/c1-17(6-2-5-16)11(19)9-18-7-3-10(4-8-18)12(13,14)15/h3H,2,4-9,16H2,1H3 |
| InChIKey | NKFDPONIIICYDM-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|