C12H19F3N4O2 — CID 50953572
N-[1-[1-[2-(carbamoylamino)ethyl]-3,6-dihydro-2H-pyridin-5-yl]-2,2,2-trifluoroethyl]acetamide (PubChem CID 50953572) has the molecular formula C12H19F3N4O2 and a molecular weight of 308.30 g/mol. Its IUPAC name is N-[1-[1-[2-(carbamoylamino)ethyl]-3,6-dihydro-2H-pyridin-5-yl]-2,2,2-trifluoroethyl]acetamide.
| Compound Name | N-[1-[1-[2-(carbamoylamino)ethyl]-3,6-dihydro-2H-pyridin-5-yl]-2,2,2-trifluoroethyl]acetamide |
|---|---|
| PubChem CID | 50953572 |
| Molecular Formula | C12H19F3N4O2 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N-[1-[1-[2-(carbamoylamino)ethyl]-3,6-dihydro-2H-pyridin-5-yl]-2,2,2-trifluoroethyl]acetamide |
| SMILES | CC(=O)NC(C1=CCCN(CCNC(N)=O)C1)C(F)(F)F |
| InChI | InChI=1S/C12H19F3N4O2/c1-8(20)18-10(12(13,14)15)9-3-2-5-19(7-9)6-4-17-11(16)21/h3,10H,2,4-7H2,1H3,(H,18,20)(H3,16,17,21) |
| InChIKey | UDPBQANENPVKHG-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|