C10H10F3NO3 — CID 114489706
(E)-4-oxo-4-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]but-2-enoic acid (PubChem CID 114489706) has the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. Its IUPAC name is (E)-4-oxo-4-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 114489706 |
| Molecular Formula | C10H10F3NO3 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | (E)-4-oxo-4-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]but-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H10F3NO3/c11-10(12,13)7-3-5-14(6-4-7)8(15)1-2-9(16)17/h1-3H,4-6H2,(H,16,17)/b2-1+ |
| InChIKey | CCLCOAKRGQXDIZ-OWOJBTEDSA-N |
| XLogP | 1.35 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|