C8H12F3NO2 — CID 82534486
(E)-3-[(dimethylamino)methyl]-5,5,5-trifluoropent-2-enoic acid (PubChem CID 82534486) has the molecular formula C8H12F3NO2 and a molecular weight of 211.18 g/mol. Its IUPAC name is (E)-3-[(dimethylamino)methyl]-5,5,5-trifluoropent-2-enoic acid.
| Compound Name | (E)-3-[(dimethylamino)methyl]-5,5,5-trifluoropent-2-enoic acid |
|---|---|
| PubChem CID | 82534486 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | (E)-3-[(dimethylamino)methyl]-5,5,5-trifluoropent-2-enoic acid |
| SMILES | CN(C)C/C(=C/C(=O)O)CC(F)(F)F |
| InChI | InChI=1S/C8H12F3NO2/c1-12(2)5-6(3-7(13)14)4-8(9,10)11/h3H,4-5H2,1-2H3,(H,13,14)/b6-3+ |
| InChIKey | OAXWCTZRTJIFPU-ZZXKWVIFSA-N |
| XLogP | 1.51 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|