C16H25NO3 — CID 114491757
1-[2-[(cyclopropylamino)methyl]-6-methoxyphenoxy]-2-methylbutan-2-ol (PubChem CID 114491757) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is 1-[2-[(cyclopropylamino)methyl]-6-methoxyphenoxy]-2-methylbutan-2-ol.
| Compound Name | 1-[2-[(cyclopropylamino)methyl]-6-methoxyphenoxy]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 114491757 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 1-[2-[(cyclopropylamino)methyl]-6-methoxyphenoxy]-2-methylbutan-2-ol |
| SMILES | CCC(C)(O)COc1c(CNC2CC2)cccc1OC |
| InChI | InChI=1S/C16H25NO3/c1-4-16(2,18)11-20-15-12(10-17-13-8-9-13)6-5-7-14(15)19-3/h5-7,13,17-18H,4,8-11H2,1-3H3 |
| InChIKey | LCEOGGUAVPXHOT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |