C15H24O3 — CID 114494496
3-[[4-(1-hydroxyethyl)-2-methylphenoxy]methyl]pentan-3-ol (PubChem CID 114494496) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 3-[[4-(1-hydroxyethyl)-2-methylphenoxy]methyl]pentan-3-ol.
| Compound Name | 3-[[4-(1-hydroxyethyl)-2-methylphenoxy]methyl]pentan-3-ol |
|---|---|
| PubChem CID | 114494496 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 3-[[4-(1-hydroxyethyl)-2-methylphenoxy]methyl]pentan-3-ol |
| SMILES | CCC(O)(CC)COc1ccc(C(C)O)cc1C |
| InChI | InChI=1S/C15H24O3/c1-5-15(17,6-2)10-18-14-8-7-13(12(4)16)9-11(14)3/h7-9,12,16-17H,5-6,10H2,1-4H3 |
| InChIKey | KDDFUCNSKDPDOO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |