C18H31NO3 — CID 11449729
(E)-3-[(4S,5R)-2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl]-1-piperidin-1-ylprop-2-en-1-one (PubChem CID 11449729) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is (E)-3-[(4S,5R)-2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl]-1-piperidin-1-ylprop-2-en-1-one.
| Compound Name | (E)-3-[(4S,5R)-2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl]-1-piperidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 11449729 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | (E)-3-[(4S,5R)-2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl]-1-piperidin-1-ylprop-2-en-1-one |
| SMILES | CCCCC[C@H]1OC(C)(C)O[C@H]1/C=C/C(=O)N1CCCCC1 |
| InChI | InChI=1S/C18H31NO3/c1-4-5-7-10-15-16(22-18(2,3)21-15)11-12-17(20)19-13-8-6-9-14-19/h11-12,15-16H,4-10,13-14H2,1-3H3/b12-11+/t15-,16+/m1/s1 |
| InChIKey | DOXPOYZMVYURGU-OEPMCUGXSA-N |
| XLogP | 3.66 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|