C11H20ClN3O2 — CID 114505682
2-chloro-N-[(1,3-dimethylpiperidin-4-yl)carbamoyl]propanamide (PubChem CID 114505682) has the molecular formula C11H20ClN3O2 and a molecular weight of 261.75 g/mol. Its IUPAC name is 2-chloro-N-[(1,3-dimethylpiperidin-4-yl)carbamoyl]propanamide.
| Compound Name | 2-chloro-N-[(1,3-dimethylpiperidin-4-yl)carbamoyl]propanamide |
|---|---|
| PubChem CID | 114505682 |
| Molecular Formula | C11H20ClN3O2 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2-chloro-N-[(1,3-dimethylpiperidin-4-yl)carbamoyl]propanamide |
| SMILES | CC(Cl)C(=O)NC(=O)NC1CCN(C)CC1C |
| InChI | InChI=1S/C11H20ClN3O2/c1-7-6-15(3)5-4-9(7)13-11(17)14-10(16)8(2)12/h7-9H,4-6H2,1-3H3,(H2,13,14,16,17) |
| InChIKey | LYLHWKNFQHCREL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|