C10H18N2O2 — CID 162424010
N-[(3R,4S)-1-acetyl-3-methylpiperidin-4-yl]acetamide (PubChem CID 162424010) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is N-[(3R,4S)-1-acetyl-3-methylpiperidin-4-yl]acetamide.
| Compound Name | N-[(3R,4S)-1-acetyl-3-methylpiperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 162424010 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | N-[(3R,4S)-1-acetyl-3-methylpiperidin-4-yl]acetamide |
| SMILES | CC(=O)N[C@H]1CCN(C(C)=O)C[C@H]1C |
| InChI | InChI=1S/C10H18N2O2/c1-7-6-12(9(3)14)5-4-10(7)11-8(2)13/h7,10H,4-6H2,1-3H3,(H,11,13)/t7-,10+/m1/s1 |
| InChIKey | ULHKKFNXGPTMHG-XCBNKYQSSA-N |
| XLogP | 0.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |