C19H30N2 — CID 114507373
1-(2,3-dihydro-1H-inden-5-ylmethyl)-N,3-diethylpiperidin-4-amine (PubChem CID 114507373) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-ylmethyl)-N,3-diethylpiperidin-4-amine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-ylmethyl)-N,3-diethylpiperidin-4-amine |
|---|---|
| PubChem CID | 114507373 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-ylmethyl)-N,3-diethylpiperidin-4-amine |
| SMILES | CCNC1CCN(Cc2ccc3c(c2)CCC3)CC1CC |
| InChI | InChI=1S/C19H30N2/c1-3-16-14-21(11-10-19(16)20-4-2)13-15-8-9-17-6-5-7-18(17)12-15/h8-9,12,16,19-20H,3-7,10-11,13-14H2,1-2H3 |
| InChIKey | NBDKWCGCTBZQRX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |