C14H18BrN — CID 80676340
3-bromo-1-(2,3-dihydro-1H-inden-5-ylmethyl)pyrrolidine (PubChem CID 80676340) has the molecular formula C14H18BrN and a molecular weight of 280.21 g/mol. Its IUPAC name is 3-bromo-1-(2,3-dihydro-1H-inden-5-ylmethyl)pyrrolidine.
| Compound Name | 3-bromo-1-(2,3-dihydro-1H-inden-5-ylmethyl)pyrrolidine |
|---|---|
| PubChem CID | 80676340 |
| Molecular Formula | C14H18BrN |
| Molecular Weight | 280.21 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 3-bromo-1-(2,3-dihydro-1H-inden-5-ylmethyl)pyrrolidine |
| SMILES | BrC1CCN(Cc2ccc3c(c2)CCC3)C1 |
| InChI | InChI=1S/C14H18BrN/c15-14-6-7-16(10-14)9-11-4-5-12-2-1-3-13(12)8-11/h4-5,8,14H,1-3,6-7,9-10H2 |
| InChIKey | IIKCAUFSROHEPG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.21 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|