C17H22BrN — CID 80669856
3-bromo-8-(2,3-dihydro-1H-inden-5-ylmethyl)-8-azabicyclo[3.2.1]octane (PubChem CID 80669856) has the molecular formula C17H22BrN and a molecular weight of 320.27 g/mol. Its IUPAC name is 3-bromo-8-(2,3-dihydro-1H-inden-5-ylmethyl)-8-azabicyclo[3.2.1]octane.
| Compound Name | 3-bromo-8-(2,3-dihydro-1H-inden-5-ylmethyl)-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 80669856 |
| Molecular Formula | C17H22BrN |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 3-bromo-8-(2,3-dihydro-1H-inden-5-ylmethyl)-8-azabicyclo[3.2.1]octane |
| SMILES | BrC1CC2CCC(C1)N2Cc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H22BrN/c18-15-9-16-6-7-17(10-15)19(16)11-12-4-5-13-2-1-3-14(13)8-12/h4-5,8,15-17H,1-3,6-7,9-11H2 |
| InChIKey | ANHJFRDEADVELV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|