C16H25FN2 — CID 114507392
N,3-diethyl-1-[(3-fluorophenyl)methyl]piperidin-4-amine (PubChem CID 114507392) has the molecular formula C16H25FN2 and a molecular weight of 264.39 g/mol. Its IUPAC name is N,3-diethyl-1-[(3-fluorophenyl)methyl]piperidin-4-amine.
| Compound Name | N,3-diethyl-1-[(3-fluorophenyl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 114507392 |
| Molecular Formula | C16H25FN2 |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | N,3-diethyl-1-[(3-fluorophenyl)methyl]piperidin-4-amine |
| SMILES | CCNC1CCN(Cc2cccc(F)c2)CC1CC |
| InChI | InChI=1S/C16H25FN2/c1-3-14-12-19(9-8-16(14)18-4-2)11-13-6-5-7-15(17)10-13/h5-7,10,14,16,18H,3-4,8-9,11-12H2,1-2H3 |
| InChIKey | APBCNSOMUHDPSX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |