C11H14FNO4 — CID 114512794
ethyl 2-(1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)-2-fluoroacetate (PubChem CID 114512794) has the molecular formula C11H14FNO4 and a molecular weight of 243.23 g/mol. Its IUPAC name is ethyl 2-(1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)-2-fluoroacetate.
| Compound Name | ethyl 2-(1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)-2-fluoroacetate |
|---|---|
| PubChem CID | 114512794 |
| Molecular Formula | C11H14FNO4 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | ethyl 2-(1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)-2-fluoroacetate |
| SMILES | CCOC(=O)C(F)N1C(=O)C2CCCC2C1=O |
| InChI | InChI=1S/C11H14FNO4/c1-2-17-11(16)8(12)13-9(14)6-4-3-5-7(6)10(13)15/h6-8H,2-5H2,1H3 |
| InChIKey | YRHVLRQKIWQDQW-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|