C13H18FNO4 — CID 114512863
ethyl 2-(5-ethyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)-2-fluoroacetate (PubChem CID 114512863) has the molecular formula C13H18FNO4 and a molecular weight of 271.29 g/mol. Its IUPAC name is ethyl 2-(5-ethyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)-2-fluoroacetate.
| Compound Name | ethyl 2-(5-ethyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)-2-fluoroacetate |
|---|---|
| PubChem CID | 114512863 |
| Molecular Formula | C13H18FNO4 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | ethyl 2-(5-ethyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)-2-fluoroacetate |
| SMILES | CCOC(=O)C(F)N1C(=O)C2CC(CC)CC2C1=O |
| InChI | InChI=1S/C13H18FNO4/c1-3-7-5-8-9(6-7)12(17)15(11(8)16)10(14)13(18)19-4-2/h7-10H,3-6H2,1-2H3 |
| InChIKey | HFEWOTGWGFQHOZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|