C17H22F4N2S — CID 11451305
(3S)-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N-(thian-4-yl)pyrrolidin-3-amine (PubChem CID 11451305) has the molecular formula C17H22F4N2S and a molecular weight of 362.44 g/mol. Its IUPAC name is (3S)-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N-(thian-4-yl)pyrrolidin-3-amine.
| Compound Name | (3S)-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N-(thian-4-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 11451305 |
| Molecular Formula | C17H22F4N2S |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (3S)-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N-(thian-4-yl)pyrrolidin-3-amine |
| SMILES | Fc1ccc(CN(C2CCSCC2)[C@H]2CCNC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H22F4N2S/c18-13-2-1-12(16(9-13)17(19,20)21)11-23(15-3-6-22-10-15)14-4-7-24-8-5-14/h1-2,9,14-15,22H,3-8,10-11H2/t15-/m0/s1 |
| InChIKey | YNVTVMSHZJUSSU-HNNXBMFYSA-N |
| XLogP | 3.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |