C13H15NO — CID 114522779
3-(3-cyclopropyloxyphenyl)-2,5-dihydro-1H-pyrrole (PubChem CID 114522779) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 3-(3-cyclopropyloxyphenyl)-2,5-dihydro-1H-pyrrole.
| Compound Name | 3-(3-cyclopropyloxyphenyl)-2,5-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 114522779 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 3-(3-cyclopropyloxyphenyl)-2,5-dihydro-1H-pyrrole |
| SMILES | C1=C(c2cccc(OC3CC3)c2)CNC1 |
| InChI | InChI=1S/C13H15NO/c1-2-10(11-6-7-14-9-11)8-13(3-1)15-12-4-5-12/h1-3,6,8,12,14H,4-5,7,9H2 |
| InChIKey | HHXQOVPUCDKFED-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |