C24H32O5 — CID 11452360
19-ethyl-15-hydroxy-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-7,13,21-trione (PubChem CID 11452360) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is 19-ethyl-15-hydroxy-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-7,13,21-trione.
| Compound Name | 19-ethyl-15-hydroxy-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-7,13,21-trione |
|---|---|
| PubChem CID | 11452360 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 19-ethyl-15-hydroxy-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-7,13,21-trione |
| SMILES | CCC1CCCC(O)C(C)C(=O)C2=CC3C(C=CC4CC(=O)CC43)C2CC(=O)O1 |
| InChI | InChI=1S/C24H32O5/c1-3-16-5-4-6-22(26)13(2)24(28)21-11-19-17(20(21)12-23(27)29-16)8-7-14-9-15(25)10-18(14)19/h7-8,11,13-14,16-20,22,26H,3-6,9-10,12H2,1-2H3 |
| InChIKey | WHWBEQVRQCZMEV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|