C15H14N4 — CID 114524411
4-(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)pyridine-2-carbonitrile (PubChem CID 114524411) has the molecular formula C15H14N4 and a molecular weight of 250.31 g/mol. Its IUPAC name is 4-(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)pyridine-2-carbonitrile.
| Compound Name | 4-(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 114524411 |
| Molecular Formula | C15H14N4 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 4-(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(N2CCc3cccc(N)c3C2)ccn1 |
| InChI | InChI=1S/C15H14N4/c16-9-12-8-13(4-6-18-12)19-7-5-11-2-1-3-15(17)14(11)10-19/h1-4,6,8H,5,7,10,17H2 |
| InChIKey | VHTCSCMSXQFAOE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|