C16H14BrN3 — CID 114885032
2-(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-6-bromobenzonitrile (PubChem CID 114885032) has the molecular formula C16H14BrN3 and a molecular weight of 328.21 g/mol. Its IUPAC name is 2-(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-6-bromobenzonitrile.
| Compound Name | 2-(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-6-bromobenzonitrile |
|---|---|
| PubChem CID | 114885032 |
| Molecular Formula | C16H14BrN3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 2-(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-6-bromobenzonitrile |
| SMILES | N#Cc1c(Br)cccc1N1CCc2cccc(N)c2C1 |
| InChI | InChI=1S/C16H14BrN3/c17-14-4-2-6-16(12(14)9-18)20-8-7-11-3-1-5-15(19)13(11)10-20/h1-6H,7-8,10,19H2 |
| InChIKey | OQOFTMDFPNGLLD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|