C9H13N5 — CID 114527828
1-[2-(1-methylimidazol-2-yl)ethyl]pyrazol-3-amine (PubChem CID 114527828) has the molecular formula C9H13N5 and a molecular weight of 191.24 g/mol. Its IUPAC name is 1-[2-(1-methylimidazol-2-yl)ethyl]pyrazol-3-amine.
| Compound Name | 1-[2-(1-methylimidazol-2-yl)ethyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 114527828 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 1-[2-(1-methylimidazol-2-yl)ethyl]pyrazol-3-amine |
| SMILES | Cn1ccnc1CCn1ccc(N)n1 |
| InChI | InChI=1S/C9H13N5/c1-13-7-4-11-9(13)3-6-14-5-2-8(10)12-14/h2,4-5,7H,3,6H2,1H3,(H2,10,12) |
| InChIKey | DGABDGAVGIUBOF-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |