C11H16N4 — CID 114528915
[1-[2-(1-methylimidazol-2-yl)ethyl]pyrrol-3-yl]methanamine (PubChem CID 114528915) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is [1-[2-(1-methylimidazol-2-yl)ethyl]pyrrol-3-yl]methanamine.
| Compound Name | [1-[2-(1-methylimidazol-2-yl)ethyl]pyrrol-3-yl]methanamine |
|---|---|
| PubChem CID | 114528915 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | [1-[2-(1-methylimidazol-2-yl)ethyl]pyrrol-3-yl]methanamine |
| SMILES | Cn1ccnc1CCn1ccc(CN)c1 |
| InChI | InChI=1S/C11H16N4/c1-14-7-4-13-11(14)3-6-15-5-2-10(8-12)9-15/h2,4-5,7,9H,3,6,8,12H2,1H3 |
| InChIKey | JZAKJNSKFLHTGT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 48.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |