C13H23N5S — CID 114527913
2-[4-[2-(1-methylimidazol-2-yl)ethyl]piperazin-1-yl]propanethioamide (PubChem CID 114527913) has the molecular formula C13H23N5S and a molecular weight of 281.43 g/mol. Its IUPAC name is 2-[4-[2-(1-methylimidazol-2-yl)ethyl]piperazin-1-yl]propanethioamide.
| Compound Name | 2-[4-[2-(1-methylimidazol-2-yl)ethyl]piperazin-1-yl]propanethioamide |
|---|---|
| PubChem CID | 114527913 |
| Molecular Formula | C13H23N5S |
| Molecular Weight | 281.43 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 2-[4-[2-(1-methylimidazol-2-yl)ethyl]piperazin-1-yl]propanethioamide |
| SMILES | CC(C(N)=S)N1CCN(CCc2nccn2C)CC1 |
| InChI | InChI=1S/C13H23N5S/c1-11(13(14)19)18-9-7-17(8-10-18)5-3-12-15-4-6-16(12)2/h4,6,11H,3,5,7-10H2,1-2H3,(H2,14,19) |
| InChIKey | MPGBHKYDEUXJCD-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.43 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|