C10H19N3O4S — CID 114533580
3-[4-(cyclopropylsulfamoyl)piperazin-1-yl]propanoic acid (PubChem CID 114533580) has the molecular formula C10H19N3O4S and a molecular weight of 277.35 g/mol. Its IUPAC name is 3-[4-(cyclopropylsulfamoyl)piperazin-1-yl]propanoic acid.
| Compound Name | 3-[4-(cyclopropylsulfamoyl)piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 114533580 |
| Molecular Formula | C10H19N3O4S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 3-[4-(cyclopropylsulfamoyl)piperazin-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCN(S(=O)(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C10H19N3O4S/c14-10(15)3-4-12-5-7-13(8-6-12)18(16,17)11-9-1-2-9/h9,11H,1-8H2,(H,14,15) |
| InChIKey | RWCNNCZRLIFHOL-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |