C11H24N4O2S — CID 114803506
4-(3-aminopropyl)-N-cyclopropyl-1,4-diazepane-1-sulfonamide (PubChem CID 114803506) has the molecular formula C11H24N4O2S and a molecular weight of 276.41 g/mol. Its IUPAC name is 4-(3-aminopropyl)-N-cyclopropyl-1,4-diazepane-1-sulfonamide.
| Compound Name | 4-(3-aminopropyl)-N-cyclopropyl-1,4-diazepane-1-sulfonamide |
|---|---|
| PubChem CID | 114803506 |
| Molecular Formula | C11H24N4O2S |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 4-(3-aminopropyl)-N-cyclopropyl-1,4-diazepane-1-sulfonamide |
| SMILES | NCCCN1CCCN(S(=O)(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C11H24N4O2S/c12-5-1-6-14-7-2-8-15(10-9-14)18(16,17)13-11-3-4-11/h11,13H,1-10,12H2 |
| InChIKey | ISJBAGVQRNUHAJ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |