About 4-(3-aminopropyl)-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide
4-(3-aminopropyl)-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide (PubChem CID 114803495) has the molecular formula C9H19F3N4O2S
and a molecular weight of 304.34 g/mol. Its IUPAC name is 4-(3-aminopropyl)-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide.
Molecular Properties
| Compound Name | 4-(3-aminopropyl)-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide |
| PubChem CID | 114803495 |
| Molecular Formula | C9H19F3N4O2S |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 4-(3-aminopropyl)-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide |
| SMILES | NCCCN1CCN(S(=O)(=O)NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H19F3N4O2S/c10-9(11,12)8-14-19(17,18)16-6-4-15(5-7-16)3-1-2-13/h14H,1-8,13H2 |
| InChIKey | CBHGTVCDMBOKJA-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3-aminopropyl)-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-aminopropyl)-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide?
The IUPAC name of 4-(3-aminopropyl)-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide (CID 114803495) is 4-(3-aminopropyl)-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide.
What is the SMILES notation for 4-(3-aminopropyl)-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide?
The canonical SMILES for 4-(3-aminopropyl)-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide is NCCCN1CCN(S(=O)(=O)NCC(F)(F)F)CC1.
What is the InChIKey of 4-(3-aminopropyl)-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide?
The InChIKey is CBHGTVCDMBOKJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19F3N4O2S/c10-9(11,12)8-14-19(17,18)16-6-4-15(5-7-16)3-1-2-13/h14H,1-8,13H2.
What are the key properties of 4-(3-aminopropyl)-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide?
4-(3-aminopropyl)-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide has a molecular weight of 304.34 g/mol, XLogP of -0.65, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-aminopropyl)-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide is sourced from PubChem (CID 114803495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).