C9H19N5O2S — CID 114813386
2-[4-(cyclopropylsulfamoyl)piperazin-1-yl]ethanimidamide (PubChem CID 114813386) has the molecular formula C9H19N5O2S and a molecular weight of 261.35 g/mol. Its IUPAC name is 2-[4-(cyclopropylsulfamoyl)piperazin-1-yl]ethanimidamide.
| Compound Name | 2-[4-(cyclopropylsulfamoyl)piperazin-1-yl]ethanimidamide |
|---|---|
| PubChem CID | 114813386 |
| Molecular Formula | C9H19N5O2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-[4-(cyclopropylsulfamoyl)piperazin-1-yl]ethanimidamide |
| SMILES | [H]/N=C(\N)CN1CCN(S(=O)(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C9H19N5O2S/c10-9(11)7-13-3-5-14(6-4-13)17(15,16)12-8-1-2-8/h8,12H,1-7H2,(H3,10,11) |
| InChIKey | QJQUUUIOJQKRKG-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|