C9H21N5O2S — CID 114813390
2-[4-(propylsulfamoyl)piperazin-1-yl]ethanimidamide (PubChem CID 114813390) has the molecular formula C9H21N5O2S and a molecular weight of 263.37 g/mol. Its IUPAC name is 2-[4-(propylsulfamoyl)piperazin-1-yl]ethanimidamide.
| Compound Name | 2-[4-(propylsulfamoyl)piperazin-1-yl]ethanimidamide |
|---|---|
| PubChem CID | 114813390 |
| Molecular Formula | C9H21N5O2S |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2-[4-(propylsulfamoyl)piperazin-1-yl]ethanimidamide |
| SMILES | [H]/N=C(\N)CN1CCN(S(=O)(=O)NCCC)CC1 |
| InChI | InChI=1S/C9H21N5O2S/c1-2-3-12-17(15,16)14-6-4-13(5-7-14)8-9(10)11/h12H,2-8H2,1H3,(H3,10,11) |
| InChIKey | KMAWVJPFRUZIPL-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|