C23H38O8 — CID 11453532
methyl (4R,7S,8S)-4,8-dimethyl-2,7-bis(oxan-2-yloxy)-3,9-dioxodecanoate (PubChem CID 11453532) has the molecular formula C23H38O8 and a molecular weight of 442.55 g/mol. Its IUPAC name is methyl (4R,7S,8S)-4,8-dimethyl-2,7-bis(oxan-2-yloxy)-3,9-dioxodecanoate.
| Compound Name | methyl (4R,7S,8S)-4,8-dimethyl-2,7-bis(oxan-2-yloxy)-3,9-dioxodecanoate |
|---|---|
| PubChem CID | 11453532 |
| Molecular Formula | C23H38O8 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | methyl (4R,7S,8S)-4,8-dimethyl-2,7-bis(oxan-2-yloxy)-3,9-dioxodecanoate |
| SMILES | COC(=O)C(OC1CCCCO1)C(=O)[C@H](C)CC[C@H](OC1CCCCO1)[C@H](C)C(C)=O |
| InChI | InChI=1S/C23H38O8/c1-15(21(25)22(23(26)27-4)31-20-10-6-8-14-29-20)11-12-18(16(2)17(3)24)30-19-9-5-7-13-28-19/h15-16,18-20,22H,5-14H2,1-4H3/t15-,16-,18+,19?,20?,22?/m1/s1 |
| InChIKey | OSXWUIVWIWXOQY-AWHFWNCASA-N |
| XLogP | 3.19 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|