C12H27N3 — CID 114537436
2-methyl-2-(3,4,5-trimethylpiperazin-1-yl)butan-1-amine (PubChem CID 114537436) has the molecular formula C12H27N3 and a molecular weight of 213.37 g/mol. Its IUPAC name is 2-methyl-2-(3,4,5-trimethylpiperazin-1-yl)butan-1-amine.
| Compound Name | 2-methyl-2-(3,4,5-trimethylpiperazin-1-yl)butan-1-amine |
|---|---|
| PubChem CID | 114537436 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | 2-methyl-2-(3,4,5-trimethylpiperazin-1-yl)butan-1-amine |
| SMILES | CCC(C)(CN)N1CC(C)N(C)C(C)C1 |
| InChI | InChI=1S/C12H27N3/c1-6-12(4,9-13)15-7-10(2)14(5)11(3)8-15/h10-11H,6-9,13H2,1-5H3 |
| InChIKey | YUNSHSNRNOAZGN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |