C13H29N3 — CID 114537611
2-ethyl-2-(3,4,5-trimethylpiperazin-1-yl)butan-1-amine (PubChem CID 114537611) has the molecular formula C13H29N3 and a molecular weight of 227.40 g/mol. Its IUPAC name is 2-ethyl-2-(3,4,5-trimethylpiperazin-1-yl)butan-1-amine.
| Compound Name | 2-ethyl-2-(3,4,5-trimethylpiperazin-1-yl)butan-1-amine |
|---|---|
| PubChem CID | 114537611 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | 2-ethyl-2-(3,4,5-trimethylpiperazin-1-yl)butan-1-amine |
| SMILES | CCC(CC)(CN)N1CC(C)N(C)C(C)C1 |
| InChI | InChI=1S/C13H29N3/c1-6-13(7-2,10-14)16-8-11(3)15(5)12(4)9-16/h11-12H,6-10,14H2,1-5H3 |
| InChIKey | DLBALBWBWXMLSR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |