C25H35NO5Si — CID 11453896
methyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate (PubChem CID 11453896) has the molecular formula C25H35NO5Si and a molecular weight of 457.64 g/mol. Its IUPAC name is methyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | methyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 11453896 |
| Molecular Formula | C25H35NO5Si |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | methyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate |
| SMILES | COC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H35NO5Si/c1-25(2,3)32(5,6)31-22(23(27)29-4)21(17-19-13-9-7-10-14-19)26-24(28)30-18-20-15-11-8-12-16-20/h7-16,21-22H,17-18H2,1-6H3,(H,26,28)/t21-,22-/m1/s1 |
| InChIKey | PVOAVDYFIVKONI-FGZHOGPDSA-N |
| XLogP | 5.09 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|