C14H22N2O2 — CID 114543927
5-(hydroxymethyl)-2-methyl-4-[[(3-methylcyclopentyl)amino]methyl]pyridin-3-ol (PubChem CID 114543927) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-methyl-4-[[(3-methylcyclopentyl)amino]methyl]pyridin-3-ol.
| Compound Name | 5-(hydroxymethyl)-2-methyl-4-[[(3-methylcyclopentyl)amino]methyl]pyridin-3-ol |
|---|---|
| PubChem CID | 114543927 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 5-(hydroxymethyl)-2-methyl-4-[[(3-methylcyclopentyl)amino]methyl]pyridin-3-ol |
| SMILES | Cc1ncc(CO)c(CNC2CCC(C)C2)c1O |
| InChI | InChI=1S/C14H22N2O2/c1-9-3-4-12(5-9)16-7-13-11(8-17)6-15-10(2)14(13)18/h6,9,12,16-18H,3-5,7-8H2,1-2H3 |
| InChIKey | JIXVFLLTMAVYSJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |