C14H17BrClNO3S — CID 114546488
3-bromo-5-[(3,3-dimethylcyclopentyl)carbamoyl]benzenesulfonyl chloride (PubChem CID 114546488) has the molecular formula C14H17BrClNO3S and a molecular weight of 394.72 g/mol. Its IUPAC name is 3-bromo-5-[(3,3-dimethylcyclopentyl)carbamoyl]benzenesulfonyl chloride.
| Compound Name | 3-bromo-5-[(3,3-dimethylcyclopentyl)carbamoyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 114546488 |
| Molecular Formula | C14H17BrClNO3S |
| Molecular Weight | 394.72 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | 3-bromo-5-[(3,3-dimethylcyclopentyl)carbamoyl]benzenesulfonyl chloride |
| SMILES | CC1(C)CCC(NC(=O)c2cc(Br)cc(S(=O)(=O)Cl)c2)C1 |
| InChI | InChI=1S/C14H17BrClNO3S/c1-14(2)4-3-11(8-14)17-13(18)9-5-10(15)7-12(6-9)21(16,19)20/h5-7,11H,3-4,8H2,1-2H3,(H,17,18) |
| InChIKey | DARINRZMVSFYHJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.72 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |