C14H19FN2O3S — CID 115880821
N-(3,3-dimethylcyclopentyl)-3-fluoro-5-sulfamoylbenzamide (PubChem CID 115880821) has the molecular formula C14H19FN2O3S and a molecular weight of 314.38 g/mol. Its IUPAC name is N-(3,3-dimethylcyclopentyl)-3-fluoro-5-sulfamoylbenzamide.
| Compound Name | N-(3,3-dimethylcyclopentyl)-3-fluoro-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 115880821 |
| Molecular Formula | C14H19FN2O3S |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-(3,3-dimethylcyclopentyl)-3-fluoro-5-sulfamoylbenzamide |
| SMILES | CC1(C)CCC(NC(=O)c2cc(F)cc(S(N)(=O)=O)c2)C1 |
| InChI | InChI=1S/C14H19FN2O3S/c1-14(2)4-3-11(8-14)17-13(18)9-5-10(15)7-12(6-9)21(16,19)20/h5-7,11H,3-4,8H2,1-2H3,(H,17,18)(H2,16,19,20) |
| InChIKey | XLSFHTMENBLBJS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |