C11H10N2O5 — CID 114553168
6-methyl-8-nitro-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylic acid (PubChem CID 114553168) has the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. Its IUPAC name is 6-methyl-8-nitro-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylic acid.
| Compound Name | 6-methyl-8-nitro-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 114553168 |
| Molecular Formula | C11H10N2O5 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 6-methyl-8-nitro-2-oxo-3,4-dihydro-1H-quinoline-3-carboxylic acid |
| SMILES | Cc1cc2c(c([N+](=O)[O-])c1)NC(=O)C(C(=O)O)C2 |
| InChI | InChI=1S/C11H10N2O5/c1-5-2-6-4-7(11(15)16)10(14)12-9(6)8(3-5)13(17)18/h2-3,7H,4H2,1H3,(H,12,14)(H,15,16) |
| InChIKey | YEBFFUKZGCAUKK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|