C12H17IN2O — CID 114553404
2-(3,5-dimethylcyclohexyl)-5-iodopyridazin-3-one (PubChem CID 114553404) has the molecular formula C12H17IN2O and a molecular weight of 332.19 g/mol. Its IUPAC name is 2-(3,5-dimethylcyclohexyl)-5-iodopyridazin-3-one.
| Compound Name | 2-(3,5-dimethylcyclohexyl)-5-iodopyridazin-3-one |
|---|---|
| PubChem CID | 114553404 |
| Molecular Formula | C12H17IN2O |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 2-(3,5-dimethylcyclohexyl)-5-iodopyridazin-3-one |
| SMILES | CC1CC(C)CC(n2ncc(I)cc2=O)C1 |
| InChI | InChI=1S/C12H17IN2O/c1-8-3-9(2)5-11(4-8)15-12(16)6-10(13)7-14-15/h6-9,11H,3-5H2,1-2H3 |
| InChIKey | MKKDFCMSCNMJRA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|