C13H20N2O — CID 99844093
2-[2-[(1S,3R)-3-methylcyclohexyl]ethyl]pyridazin-3-one (PubChem CID 99844093) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-[2-[(1S,3R)-3-methylcyclohexyl]ethyl]pyridazin-3-one.
| Compound Name | 2-[2-[(1S,3R)-3-methylcyclohexyl]ethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 99844093 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2-[2-[(1S,3R)-3-methylcyclohexyl]ethyl]pyridazin-3-one |
| SMILES | C[C@@H]1CCC[C@H](CCn2ncccc2=O)C1 |
| InChI | InChI=1S/C13H20N2O/c1-11-4-2-5-12(10-11)7-9-15-13(16)6-3-8-14-15/h3,6,8,11-12H,2,4-5,7,9-10H2,1H3/t11-,12-/m1/s1 |
| InChIKey | RZIXIEBXGSTWQJ-VXGBXAGGSA-N |
| XLogP | 2.46 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |