C34H37NO8 — CID 11456057
[(2R,3S,4R,5R,6R)-5-acetamido-4-acetyloxy-6-[(Z)-prop-1-enoxy]-2-(trityloxymethyl)oxan-3-yl] acetate (PubChem CID 11456057) has the molecular formula C34H37NO8 and a molecular weight of 587.67 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-acetamido-4-acetyloxy-6-[(Z)-prop-1-enoxy]-2-(trityloxymethyl)oxan-3-yl] acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-acetamido-4-acetyloxy-6-[(Z)-prop-1-enoxy]-2-(trityloxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 11456057 |
| Molecular Formula | C34H37NO8 |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-acetamido-4-acetyloxy-6-[(Z)-prop-1-enoxy]-2-(trityloxymethyl)oxan-3-yl] acetate |
| SMILES | C/C=C\O[C@@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C34H37NO8/c1-5-21-39-33-30(35-23(2)36)32(42-25(4)38)31(41-24(3)37)29(43-33)22-40-34(26-15-9-6-10-16-26,27-17-11-7-12-18-27)28-19-13-8-14-20-28/h5-21,29-33H,22H2,1-4H3,(H,35,36)/b21-5-/t29-,30-,31-,32-,33-/m1/s1 |
| InChIKey | DHRKTSKRFFMWBG-VIFFUVDASA-N |
| XLogP | 4.64 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|